Edit: As Iyionaku pointed out, it's more convenient for everyone to have the story in one block, so here it is:
Once upon a time, there were two friends, Ron and John. They decided to travel and see the world together. One day, they decided to go to the forest. The forest was very big and they knew that anything bad could happen to them at any time. They promised each other that they would stick together in case anything bad happened to them. Suddenly, they heard a terrifying roar and then saw a big bear coming in their direction. They were seized by fear. Ron ran quickly and climbed a tree which was nearby, leaving John behind. John didn't know how to climb the tree so he asked Ron: "Can you help me climb the tree? The bear is going to eat me! Please, help me!" I can't come down! The bear is getting close. And there's no space up here. Now, go and find a place to hide. Ron didn't help John, but John was a clever child. At school, he heard the teacher say that bears don't eat dead meat. So, using his wisdom, he lay down on the ground without breathing, pretending to be dead. The bear came near to where he was lying. It sniffed at his ears and slowly left that place because bears don't touch dead meat. After the bear left, his friend came down from the tree and asked John. "What did the bear say into your ear? "The bear told me not to listen to fake friends who leave me at a time of problems."Here is the video where I got this from. The subtitles might be a little bit different than my translation.
Swahili
I hear a few non-standard pronunciations in the video: hivo for hivyo, katafte for katafute and unaeza for unaweza. Also, it sounds like the narrator lisps at times, saying thana instead of sana, but that could just be an audio issue.
Dubu na marafiki wawili.
dubu na ma-rafiki wa-wili
bear(CL9) COM CL6-friends(CL10) CL2-two
The bear and the two friends.
Hapo zamani za kale kulikuwa na marafiki wawili, Ron na John.
hapo zamani z-a kale ku-li-ku-w(a) na ma-rafiki wa-wili | Ron na John
DEM.MED.CL16 old.times(CL10) CL10-GEN old.times CL17-PST-EXT-be COM CL6-friends(CL10) CL2-two | Ron COM John
Once upon a time, there were two friends, Ron and John.
("At that time in the old times of old, imprecise place had two friends, Ron with John.")
Waliamua kusafiri na kuona dunia pamoja.
wa-li-amu(a) ku-safiri na ku-on(a) dunia pa-moja
CL2-PST-decide INF(CL15)-travel COM INF(CL15)-see world(CL9) CL16-one
They decided to travel and see the world together.
("They decided to travel with to see the world together.")
Siku moja, waliamua kwenda msituni.
siku Ø-moja | wa-li-amu(a) kw-end(a) msitu-ni
nychthemeron(CL9) CL9-one | CL2-PST-decide INF(CL15)-go forest(CL3)-LOC(CL16/17/18)
One day, they decided to go to the forest.
Msitu huo ulikuwa mkubwa sana na walijua jambo lolote baya linaweza kuwatendekea wakati wowote.
msitu huo u-li-ku-w(a) m-kubwa sana na wa-li-ju(a) jambo l-o-l-ote Ø-baya li-na-wez(a) ku-wa-tend(a)-ek(a)-e(a) wakati w-o-w-ote
forest(CL3) DEM.MED.CL3 CL3-PST-EXT-be CL3-big very COM CL2-PST-know abstract.thing(CL5) CL5-any1-CL5-any2 CL5-bad CL5-PRES-be.able INF(CL15)-CL2-act-MEDIOPASS-APPL time(CL11) CL11-any1-CL11-any2
The forest was very big and they knew that anything bad could happen to them at any time.
Waliahidiana ya kwamba watakuwa na muungano iwapo lolote baya litawatendekea.
wa-li-ahidi-an(a) y-a kwamba wa-ta-ku-w(a) na muungano i-w(a)-po l-o-l-ote Ø-baya li-ta-wa-tend(a)-ek(a)-e(a)
CL2-PST-promise-RECIP CL9-GEN C CL2-FUT-EXT-be COM alliance(CL3) CL9-be-CL16.REL CL5-bad CL5-FUT-CL2-act-MEDIOPASS-APPL
They promised each other that they would stick together in case anything bad happened to them.
("They promised each other of that they will have an alliance in case anything bad will happen to them")
Ghafla wakasikia mngurumo wa kutisha na wakaona dubu mkubwa akija upande wao.
ghafla | wa-ka-siki(a) mngurumo w-a ku-tish(a) na wa-ka-on(a) dubu m-kubwa a-ki-j(a) upande w-ao
suddenly | CL2-CONSEQ-hear roar(CL3) CL3-GEN INF(CL15)-intimidate COM CL2-CONSEQ-see bear(CL9) CL1-big CL1-SITU-come direction(CL11) CL11-GEN.CL2
Suddenly, they heard a terrifying roar and then saw a big bear coming in their direction.
Walipatwa na woga.
wa-li-pat(a)-w(a) na woga
CL2-PST-obtain-PASS COM fear(CL14)
They were seized by fear.
Ron alikimbia haraka na kupanda mti ulio karibu akimwacha John nyuma.
Ron a-li-kimbi(a) haraka na ku-pand(a) mti u-li-o karibu a-ki-mw-ach(a) John nyuma
Ron CL1-PST-run(.from) fast COM INF(CL15)-climb tree(CL3) CL3-be.REL.PRES-CL3.REL near CL1-SITU-CL1-leave John behind
Run ran quickly and climbed a tree which was nearby, leaving John behind.
John alikuwa hajui kupanda mti hivyo akamuuliza Ron:
John a-li-ku-w(a) h-a-ju(a)-i ku-pand(a) mti hivyo a-ka-mu-uliz(a) Ron
John CL1-PST-EXT-be NEG-CL1-know-NEG.PRES INF(CL15)-climb tree(CL3) DEM.MED.CL8 CL1-CONSEQ-CL1-ask Ron
John didn't know how to climb the tree so he asked Ron:
"Unaweza nisaidia kupanda mti? Dubu atanila! Tafadhali, nisaidie!"
u-na-wez(a) (ku)-ni-saidi(a) ku-pand(a) mti | dubu a-ta-ni-l(a) | tafadhali | ni-saidi(a)-e
2S-PRES-be.able (INF(CL15)-2S-help INF(CL15)-climb tree | bear(CL9) CL1-FUT-1S-eat | please | 1S-help-SBJV
"Can you help me climb the tree? The bear is going to eat me! Please, help me!"
"Siwezi kushuka! Dubu anakaribia. Na hapa juu pamejaa."
si-wez(a)-i ku-shuk(a) | dubu a-na-karibi(a) | na hapa juu pa-me-jaa
NEG.1S-be.able-NEG.PRES INF(CL15)-descend | bear(CL9) CL1-PRES-draw.near | COM DEM.PROX.CL16 top(CL9) CL16-PRF-fill(INTR)
I can't come down! The bear is getting close. And there's no space up here.
("I can't descend. The bear approaches. And up here has filled up.")
"Haya nenda katafute pale pako pa kujificha."
haya nenda ka-tafut(a)-e pale p-ako p-a ku-ji-fich(a)
now.then go(IMP) CONSEQ-seek-SBJV DEM.DIST.CL16 CL16-GEN.2S CL16-GEN INF(CL15)-REFL-hide(TR)
Now, go and find a place to hide.
("Now then, go and then find your "there" of hiding oneself.)
Ron hakumsaidia John, lakini John alikuwa ni mtoto mwerevu.
Ron h-a-ku-m-saidi(a) John | lakini John a-li-ku-w(a) mtoto mw-erevu
Ron NEG-CL1-NEG.PST-CL1-help John | but John CL1-PST-EXT-be child(CL1) CL1-clever
Ron didn't help John, but John was a clever child.
Shuleni alisikia mwalimu akisema ya kwamba dubu hawali mizoga.
shule-ni a-li-siki(a) mwalimu a-ki-sem(a) y-a kwamba dubu ha-wa-l(a)-i mizoga
school(CL9)-LOC(CL16/17/18) CL1-PST-hear techer(CL1) CL1-SITU-say CL9-GEN C bears(CL10) NEG-CL2-eat-NEG.PRES carcasses(CL4)
At school, he heard the teacher say that bears don't eat dead meat.
Hivyo, akitumia hekima yake, alilala chini kwenye ardhi bila kupumua akijifana kuwa amekufa.
hivyo | a-ki-tumi(a) hekima y-ake | a-li-lal(a) chini kw-enye ardhi bila ku-pumu(a) | a-ki-ji-fany(a) ku-w(a) a-me-ku-f(a)
DEM.MED.CL8 | CL1-SITU-use wisdom(CL9) CL9-GEN.3S | CL1-PST-lie.down down CL17-ORNATIVE earth(CL9) without INF(CL15)-breath | CL1-SITU-REFL-do INF(CL15)-be CL1-PRF-EXT-die
So, using his wisdom, he lay down on the ground without breathing, pretending to be dead.
Dubu alikuja karibu na alipolala.
dubu a-li-ku-j(a) karibu na a-li-po-lal(a)
bear(CL9) CL1-PST-EXT-come near COM CL1-PST-CL16.REL-lie.down
The bear came near to where he was lying.
Alinusa masikio yake na polepole akaondoka pale kwa sababu dubu hawashiki mizoga.
a-li-nus(a) masikio y-ake na polepole a-ka-ondok(a) pale kw-a sababu dubu ha-wa-shik(a)-i mizoga
CL1-PST-smell(TR) ears(CL6) CL6-3S COM slowly CL1-CONSEQ-leave DEM.DIST.CL16 CL15/17-GEN reason(CL9) bears(CL10) NEG-CL1-grasp-NEG.PRES carcasses(CL4)
It sniffed at his ears and slowly left that place because bears don't touch dead meat.
Baada ya dubu kuondoka, rafiki yake alishuka kutoka mti na kumuuliza John:
baada y-a dubu ku-ondok(a) | rafiki y-ake a-li-shuk(a) ku-tok(a) mti na ku-mu-uliz(a) John
after(CL9) CL9-GEN bear(CL9) INF(CL15)-leave | friend(CL9) CL9-GEN.3S CL1-PST-descend INF(CL15)-go.out tree(CL3) COM INF(CL15)-CL1-ask John
After the bear left, his friend came down from the tree and asked John.
"Dubu alikuambia nini sikioni?"
dubu a-li-ku-ambi(a) nini sikio-ni
bear(CL9) CL1-PST-2S-tell what ear(CL5)-LOC(CL16/17/18)
"What did the bear say into your ear?
"Dubu aliniambia nisisikize marafiki wa uongo wanaoniacha wakati wa shida."
dubu a-li-ni-ambi(a) ni-si-sikiz(a)-e ma-rafiki w-a uongo wa-na-o-ni-ach(a) wakati w-a shida
bear(CL9) CL1-PST-1S-tell 1S-NEG-listen.to-SBJV CL6-friends(CL10) CL2-GEN lie/falsehood(CL14) CL2-PRES-CL2.REL-1S-leave time(CL11) CL11-GEN problems(CL10)
"The bear told me not to listen to fake friends who leave me at a time of problems."